AB620573 | CAS 15948-60-4
Bis(4-chlorophenyl)phosphine oxide; .
| Physical and Hazardous Characteristics | |
|---|---|
| Sum formula | |
| Molecular weight | |
| Density | |
| Melting point | |
| Boiling point | |
| Flash point | |
| Safety instructions |
|---|
| Physical and Hazardous Characteristics | |
|---|---|
| Sum formula | |
| Molecular weight | |
| Density | |
| Melting point | |
| Boiling point | |
| Flash point | |
| Safety instructions |
|---|
abcr GmbH Deutschland
© 2025. abcr GmbH, Karlsruhe, Germany and/or its affiliates. All rights reserved